About fluoro octane-1-sulfonate;1-methylsulfanylheptan-2-one
fluoro octane-1-sulfonate;1-methylsulfanylheptan-2-one (PubChem CID 174410132) has the molecular formula C16H33FO4S2
and a molecular weight of 372.57 g/mol. Its IUPAC name is fluoro octane-1-sulfonate;1-methylsulfanylheptan-2-one.
Molecular Properties
| Compound Name | fluoro octane-1-sulfonate;1-methylsulfanylheptan-2-one |
| PubChem CID | 174410132 |
| Molecular Formula | C16H33FO4S2 |
| Molecular Weight | 372.57 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | fluoro octane-1-sulfonate;1-methylsulfanylheptan-2-one |
| SMILES | CCCCCC(=O)CSC.CCCCCCCCS(=O)(=O)OF |
| InChI | InChI=1S/C8H17FO3S.C8H16OS/c1-2-3-4-5-6-7-8-13(10,11)12-9;1-3-4-5-6-8(9)7-10-2/h2-8H2,1H3;3-7H2,1-2H3 |
| InChIKey | QXRNZSPJHZZCLH-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.57 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze fluoro octane-1-sulfonate;1-methylsulfanylheptan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro octane-1-sulfonate;1-methylsulfanylheptan-2-one?
The IUPAC name of fluoro octane-1-sulfonate;1-methylsulfanylheptan-2-one (CID 174410132) is fluoro octane-1-sulfonate;1-methylsulfanylheptan-2-one.
What is the SMILES notation for fluoro octane-1-sulfonate;1-methylsulfanylheptan-2-one?
The canonical SMILES for fluoro octane-1-sulfonate;1-methylsulfanylheptan-2-one is CCCCCC(=O)CSC.CCCCCCCCS(=O)(=O)OF.
What is the InChIKey of fluoro octane-1-sulfonate;1-methylsulfanylheptan-2-one?
The InChIKey is QXRNZSPJHZZCLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17FO3S.C8H16OS/c1-2-3-4-5-6-7-8-13(10,11)12-9;1-3-4-5-6-8(9)7-10-2/h2-8H2,1H3;3-7H2,1-2H3.
What are the key properties of fluoro octane-1-sulfonate;1-methylsulfanylheptan-2-one?
fluoro octane-1-sulfonate;1-methylsulfanylheptan-2-one has a molecular weight of 372.57 g/mol, XLogP of 5.08, 14 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro octane-1-sulfonate;1-methylsulfanylheptan-2-one is sourced from PubChem (CID 174410132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).