About fluoro octane-1-sulfonate;zirconium
fluoro octane-1-sulfonate;zirconium (PubChem CID 175196316) has the molecular formula C8H17FO3SZr
and a molecular weight of 303.51 g/mol. Its IUPAC name is fluoro octane-1-sulfonate;zirconium.
Molecular Properties
| Compound Name | fluoro octane-1-sulfonate;zirconium |
| PubChem CID | 175196316 |
| Molecular Formula | C8H17FO3SZr |
| Molecular Weight | 303.51 g/mol |
| Exact Mass | 301.99 |
| IUPAC Name | fluoro octane-1-sulfonate;zirconium |
| SMILES | CCCCCCCCS(=O)(=O)OF.[Zr] |
| InChI | InChI=1S/C8H17FO3S.Zr/c1-2-3-4-5-6-7-8-13(10,11)12-9;/h2-8H2,1H3; |
| InChIKey | TZSSCYHAJTYITB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.51 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze fluoro octane-1-sulfonate;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro octane-1-sulfonate;zirconium?
The IUPAC name of fluoro octane-1-sulfonate;zirconium (CID 175196316) is fluoro octane-1-sulfonate;zirconium.
What is the SMILES notation for fluoro octane-1-sulfonate;zirconium?
The canonical SMILES for fluoro octane-1-sulfonate;zirconium is CCCCCCCCS(=O)(=O)OF.[Zr].
What is the InChIKey of fluoro octane-1-sulfonate;zirconium?
The InChIKey is TZSSCYHAJTYITB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17FO3S.Zr/c1-2-3-4-5-6-7-8-13(10,11)12-9;/h2-8H2,1H3;.
What are the key properties of fluoro octane-1-sulfonate;zirconium?
fluoro octane-1-sulfonate;zirconium has a molecular weight of 303.51 g/mol, XLogP of 2.58, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro octane-1-sulfonate;zirconium is sourced from PubChem (CID 175196316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).