About fluoro octane-1-sulfonate;tetrapropylazanium
fluoro octane-1-sulfonate;tetrapropylazanium (PubChem CID 174418186) has the molecular formula C20H45FNO3S+
and a molecular weight of 398.65 g/mol. Its IUPAC name is fluoro octane-1-sulfonate;tetrapropylazanium.
Molecular Properties
| Compound Name | fluoro octane-1-sulfonate;tetrapropylazanium |
| PubChem CID | 174418186 |
| Molecular Formula | C20H45FNO3S+ |
| Molecular Weight | 398.65 g/mol |
| Exact Mass | 398.31 |
| IUPAC Name | fluoro octane-1-sulfonate;tetrapropylazanium |
| SMILES | CCCCCCCCS(=O)(=O)OF.CCC[N+](CCC)(CCC)CCC |
| InChI | InChI=1S/C12H28N.C8H17FO3S/c1-5-9-13(10-6-2,11-7-3)12-8-4;1-2-3-4-5-6-7-8-13(10,11)12-9/h5-12H2,1-4H3;2-8H2,1H3/q+1; |
| InChIKey | RECHLCGTYVAJKL-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.65 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze fluoro octane-1-sulfonate;tetrapropylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro octane-1-sulfonate;tetrapropylazanium?
The IUPAC name of fluoro octane-1-sulfonate;tetrapropylazanium (CID 174418186) is fluoro octane-1-sulfonate;tetrapropylazanium.
What is the SMILES notation for fluoro octane-1-sulfonate;tetrapropylazanium?
The canonical SMILES for fluoro octane-1-sulfonate;tetrapropylazanium is CCCCCCCCS(=O)(=O)OF.CCC[N+](CCC)(CCC)CCC.
What is the InChIKey of fluoro octane-1-sulfonate;tetrapropylazanium?
The InChIKey is RECHLCGTYVAJKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H28N.C8H17FO3S/c1-5-9-13(10-6-2,11-7-3)12-8-4;1-2-3-4-5-6-7-8-13(10,11)12-9/h5-12H2,1-4H3;2-8H2,1H3/q+1;.
What are the key properties of fluoro octane-1-sulfonate;tetrapropylazanium?
fluoro octane-1-sulfonate;tetrapropylazanium has a molecular weight of 398.65 g/mol, XLogP of 6.02, 16 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro octane-1-sulfonate;tetrapropylazanium is sourced from PubChem (CID 174418186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).