C7H12F4O6S2 — CID 87128232
2-(2,2-difluoroethylsulfonyloxy)propyl 2,2-difluoroethanesulfonate (PubChem CID 87128232) has the molecular formula C7H12F4O6S2 and a molecular weight of 332.29 g/mol. Its IUPAC name is 2-(2,2-difluoroethylsulfonyloxy)propyl 2,2-difluoroethanesulfonate.
| Compound Name | 2-(2,2-difluoroethylsulfonyloxy)propyl 2,2-difluoroethanesulfonate |
|---|---|
| PubChem CID | 87128232 |
| Molecular Formula | C7H12F4O6S2 |
| Molecular Weight | 332.29 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | 2-(2,2-difluoroethylsulfonyloxy)propyl 2,2-difluoroethanesulfonate |
| SMILES | CC(COS(=O)(=O)CC(F)F)OS(=O)(=O)CC(F)F |
| InChI | InChI=1S/C7H12F4O6S2/c1-5(17-19(14,15)4-7(10)11)2-16-18(12,13)3-6(8)9/h5-7H,2-4H2,1H3 |
| InChIKey | VJGNMAAJRWATCB-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.29 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|