About potassium;hydride;2-methylpropyl 2-methylpropane-1-sulfonate
potassium;hydride;2-methylpropyl 2-methylpropane-1-sulfonate (PubChem CID 175022763) has the molecular formula C8H19KO3S
and a molecular weight of 234.40 g/mol. Its IUPAC name is potassium;hydride;2-methylpropyl 2-methylpropane-1-sulfonate.
Molecular Properties
| Compound Name | potassium;hydride;2-methylpropyl 2-methylpropane-1-sulfonate |
| PubChem CID | 175022763 |
| Molecular Formula | C8H19KO3S |
| Molecular Weight | 234.40 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | potassium;hydride;2-methylpropyl 2-methylpropane-1-sulfonate |
| SMILES | CC(C)COS(=O)(=O)CC(C)C.[H-].[K+] |
| InChI | InChI=1S/C8H18O3S.K.H/c1-7(2)5-11-12(9,10)6-8(3)4;;/h7-8H,5-6H2,1-4H3;;/q;+1;-1 |
| InChIKey | QOKHHQYUNPYAFK-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.40 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze potassium;hydride;2-methylpropyl 2-methylpropane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hydride;2-methylpropyl 2-methylpropane-1-sulfonate?
The IUPAC name of potassium;hydride;2-methylpropyl 2-methylpropane-1-sulfonate (CID 175022763) is potassium;hydride;2-methylpropyl 2-methylpropane-1-sulfonate.
What is the SMILES notation for potassium;hydride;2-methylpropyl 2-methylpropane-1-sulfonate?
The canonical SMILES for potassium;hydride;2-methylpropyl 2-methylpropane-1-sulfonate is CC(C)COS(=O)(=O)CC(C)C.[H-].[K+].
What is the InChIKey of potassium;hydride;2-methylpropyl 2-methylpropane-1-sulfonate?
The InChIKey is QOKHHQYUNPYAFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O3S.K.H/c1-7(2)5-11-12(9,10)6-8(3)4;;/h7-8H,5-6H2,1-4H3;;/q;+1;-1.
What are the key properties of potassium;hydride;2-methylpropyl 2-methylpropane-1-sulfonate?
potassium;hydride;2-methylpropyl 2-methylpropane-1-sulfonate has a molecular weight of 234.40 g/mol, XLogP of -1.24, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;2-methylpropyl 2-methylpropane-1-sulfonate is sourced from PubChem (CID 175022763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).