About sodium;2-aminopropyl hydroxymethanesulfonate;hydride
sodium;2-aminopropyl hydroxymethanesulfonate;hydride (PubChem CID 173101119) has the molecular formula C4H12NNaO4S
and a molecular weight of 193.20 g/mol. Its IUPAC name is sodium;2-aminopropyl hydroxymethanesulfonate;hydride.
Molecular Properties
| Compound Name | sodium;2-aminopropyl hydroxymethanesulfonate;hydride |
| PubChem CID | 173101119 |
| Molecular Formula | C4H12NNaO4S |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.04 |
| IUPAC Name | sodium;2-aminopropyl hydroxymethanesulfonate;hydride |
| SMILES | CC(N)COS(=O)(=O)CO.[H-].[Na+] |
| InChI | InChI=1S/C4H11NO4S.Na.H/c1-4(5)2-9-10(7,8)3-6;;/h4,6H,2-3,5H2,1H3;;/q;+1;-1 |
| InChIKey | KLCWABHCRHSWNX-UHFFFAOYSA-N |
| XLogP | -4.25 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | -4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;2-aminopropyl hydroxymethanesulfonate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-aminopropyl hydroxymethanesulfonate;hydride?
The IUPAC name of sodium;2-aminopropyl hydroxymethanesulfonate;hydride (CID 173101119) is sodium;2-aminopropyl hydroxymethanesulfonate;hydride.
What is the SMILES notation for sodium;2-aminopropyl hydroxymethanesulfonate;hydride?
The canonical SMILES for sodium;2-aminopropyl hydroxymethanesulfonate;hydride is CC(N)COS(=O)(=O)CO.[H-].[Na+].
What is the InChIKey of sodium;2-aminopropyl hydroxymethanesulfonate;hydride?
The InChIKey is KLCWABHCRHSWNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11NO4S.Na.H/c1-4(5)2-9-10(7,8)3-6;;/h4,6H,2-3,5H2,1H3;;/q;+1;-1.
What are the key properties of sodium;2-aminopropyl hydroxymethanesulfonate;hydride?
sodium;2-aminopropyl hydroxymethanesulfonate;hydride has a molecular weight of 193.20 g/mol, XLogP of -4.25, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-aminopropyl hydroxymethanesulfonate;hydride is sourced from PubChem (CID 173101119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).