About sodium;hydride;2-hydroxypropyl 2-aminoethanesulfonate
sodium;hydride;2-hydroxypropyl 2-aminoethanesulfonate (PubChem CID 175347069) has the molecular formula C5H14NNaO4S
and a molecular weight of 207.23 g/mol. Its IUPAC name is sodium;hydride;2-hydroxypropyl 2-aminoethanesulfonate.
Molecular Properties
| Compound Name | sodium;hydride;2-hydroxypropyl 2-aminoethanesulfonate |
| PubChem CID | 175347069 |
| Molecular Formula | C5H14NNaO4S |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | sodium;hydride;2-hydroxypropyl 2-aminoethanesulfonate |
| SMILES | CC(O)COS(=O)(=O)CCN.[H-].[Na+] |
| InChI | InChI=1S/C5H13NO4S.Na.H/c1-5(7)4-10-11(8,9)3-2-6;;/h5,7H,2-4,6H2,1H3;;/q;+1;-1 |
| InChIKey | DUHSSWNSOXDTJJ-UHFFFAOYSA-N |
| XLogP | -4.21 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | -4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;2-hydroxypropyl 2-aminoethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;2-hydroxypropyl 2-aminoethanesulfonate?
The IUPAC name of sodium;hydride;2-hydroxypropyl 2-aminoethanesulfonate (CID 175347069) is sodium;hydride;2-hydroxypropyl 2-aminoethanesulfonate.
What is the SMILES notation for sodium;hydride;2-hydroxypropyl 2-aminoethanesulfonate?
The canonical SMILES for sodium;hydride;2-hydroxypropyl 2-aminoethanesulfonate is CC(O)COS(=O)(=O)CCN.[H-].[Na+].
What is the InChIKey of sodium;hydride;2-hydroxypropyl 2-aminoethanesulfonate?
The InChIKey is DUHSSWNSOXDTJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13NO4S.Na.H/c1-5(7)4-10-11(8,9)3-2-6;;/h5,7H,2-4,6H2,1H3;;/q;+1;-1.
What are the key properties of sodium;hydride;2-hydroxypropyl 2-aminoethanesulfonate?
sodium;hydride;2-hydroxypropyl 2-aminoethanesulfonate has a molecular weight of 207.23 g/mol, XLogP of -4.21, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;2-hydroxypropyl 2-aminoethanesulfonate is sourced from PubChem (CID 175347069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).