About 2-aminoethylsulfonyl 2-propylpentanoate
2-aminoethylsulfonyl 2-propylpentanoate (PubChem CID 91070994) has the molecular formula C10H21NO4S
and a molecular weight of 251.35 g/mol. Its IUPAC name is 2-aminoethylsulfonyl 2-propylpentanoate.
Molecular Properties
| Compound Name | 2-aminoethylsulfonyl 2-propylpentanoate |
| PubChem CID | 91070994 |
| Molecular Formula | C10H21NO4S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 2-aminoethylsulfonyl 2-propylpentanoate |
| SMILES | CCCC(CCC)C(=O)OS(=O)(=O)CCN |
| InChI | InChI=1S/C10H21NO4S/c1-3-5-9(6-4-2)10(12)15-16(13,14)8-7-11/h9H,3-8,11H2,1-2H3 |
| InChIKey | DIHKVPYXDILXIT-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethylsulfonyl 2-propylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethylsulfonyl 2-propylpentanoate?
The IUPAC name of 2-aminoethylsulfonyl 2-propylpentanoate (CID 91070994) is 2-aminoethylsulfonyl 2-propylpentanoate.
What is the SMILES notation for 2-aminoethylsulfonyl 2-propylpentanoate?
The canonical SMILES for 2-aminoethylsulfonyl 2-propylpentanoate is CCCC(CCC)C(=O)OS(=O)(=O)CCN.
What is the InChIKey of 2-aminoethylsulfonyl 2-propylpentanoate?
The InChIKey is DIHKVPYXDILXIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO4S/c1-3-5-9(6-4-2)10(12)15-16(13,14)8-7-11/h9H,3-8,11H2,1-2H3.
What are the key properties of 2-aminoethylsulfonyl 2-propylpentanoate?
2-aminoethylsulfonyl 2-propylpentanoate has a molecular weight of 251.35 g/mol, XLogP of 1.03, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethylsulfonyl 2-propylpentanoate is sourced from PubChem (CID 91070994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).