C8H21N3O5S — CID 175285928
3-aminopropylsulfonyl 2-hydroxypropanoate;ethane-1,2-diamine (PubChem CID 175285928) has the molecular formula C8H21N3O5S and a molecular weight of 271.34 g/mol. Its IUPAC name is 3-aminopropylsulfonyl 2-hydroxypropanoate;ethane-1,2-diamine.
| Compound Name | 3-aminopropylsulfonyl 2-hydroxypropanoate;ethane-1,2-diamine |
|---|---|
| PubChem CID | 175285928 |
| Molecular Formula | C8H21N3O5S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 3-aminopropylsulfonyl 2-hydroxypropanoate;ethane-1,2-diamine |
| SMILES | CC(O)C(=O)OS(=O)(=O)CCCN.NCCN |
| InChI | InChI=1S/C6H13NO5S.C2H8N2/c1-5(8)6(9)12-13(10,11)4-2-3-7;3-1-2-4/h5,8H,2-4,7H2,1H3;1-4H2 |
| InChIKey | UPYGGAXXYPNERT-UHFFFAOYSA-N |
| XLogP | -2.51 |
| TPSA | 158.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|