C11H18NNaO4S — CID 175132943
sodium;hydride;2-hydroxypropyl N-(3,5-dimethylphenyl)sulfamate (PubChem CID 175132943) has the molecular formula C11H18NNaO4S and a molecular weight of 283.32 g/mol. Its IUPAC name is sodium;hydride;2-hydroxypropyl N-(3,5-dimethylphenyl)sulfamate.
| Compound Name | sodium;hydride;2-hydroxypropyl N-(3,5-dimethylphenyl)sulfamate |
|---|---|
| PubChem CID | 175132943 |
| Molecular Formula | C11H18NNaO4S |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | sodium;hydride;2-hydroxypropyl N-(3,5-dimethylphenyl)sulfamate |
| SMILES | Cc1cc(C)cc(NS(=O)(=O)OCC(C)O)c1.[H-].[Na+] |
| InChI | InChI=1S/C11H17NO4S.Na.H/c1-8-4-9(2)6-11(5-8)12-17(14,15)16-7-10(3)13;;/h4-6,10,12-13H,7H2,1-3H3;;/q;+1;-1 |
| InChIKey | VOSNNKWMSUOWAJ-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |