C12H27AlO3S — CID 139725086
bis(2-methylpropyl)alumanyl 2-methylpropane-1-sulfonate (PubChem CID 139725086) has the molecular formula C12H27AlO3S and a molecular weight of 278.39 g/mol. Its IUPAC name is bis(2-methylpropyl)alumanyl 2-methylpropane-1-sulfonate.
| Compound Name | bis(2-methylpropyl)alumanyl 2-methylpropane-1-sulfonate |
|---|---|
| PubChem CID | 139725086 |
| Molecular Formula | C12H27AlO3S |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | bis(2-methylpropyl)alumanyl 2-methylpropane-1-sulfonate |
| SMILES | CC(C)C[Al](CC(C)C)OS(=O)(=O)CC(C)C |
| InChI | InChI=1S/C4H10O3S.2C4H9.Al/c1-4(2)3-8(5,6)7;2*1-4(2)3;/h4H,3H2,1-2H3,(H,5,6,7);2*4H,1H2,2-3H3;/q;;;+1/p-1 |
| InChIKey | OWOVKEKGVZKTEQ-UHFFFAOYSA-M |
| XLogP | 3.29 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |