C7H13NNaO4S — CID 86745857
CID 86745857 (PubChem CID 86745857) has the molecular formula C7H13NNaO4S and a molecular weight of 230.24 g/mol.
| Compound Name | CID 86745857 |
|---|---|
| PubChem CID | 86745857 |
| Molecular Formula | C7H13NNaO4S |
| Molecular Weight | 230.24 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | — |
| SMILES | C=CC(=O)NOS(=O)(=O)CC(C)C.[Na] |
| InChI | InChI=1S/C7H13NO4S.Na/c1-4-7(9)8-12-13(10,11)5-6(2)3;/h4,6H,1,5H2,2-3H3,(H,8,9); |
| InChIKey | UYHLLFRNFXMTIM-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.24 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|