About 2-methylpropane-1-sulfonic acid;2-methylprop-2-enoic acid;prop-2-enamide
2-methylpropane-1-sulfonic acid;2-methylprop-2-enoic acid;prop-2-enamide (PubChem CID 157185498) has the molecular formula C11H21NO6S
and a molecular weight of 295.36 g/mol. Its IUPAC name is 2-methylpropane-1-sulfonic acid;2-methylprop-2-enoic acid;prop-2-enamide.
Molecular Properties
| Compound Name | 2-methylpropane-1-sulfonic acid;2-methylprop-2-enoic acid;prop-2-enamide |
| PubChem CID | 157185498 |
| Molecular Formula | C11H21NO6S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 2-methylpropane-1-sulfonic acid;2-methylprop-2-enoic acid;prop-2-enamide |
| SMILES | C=C(C)C(=O)O.C=CC(N)=O.CC(C)CS(=O)(=O)O |
| InChI | InChI=1S/C4H10O3S.C4H6O2.C3H5NO/c1-4(2)3-8(5,6)7;1-3(2)4(5)6;1-2-3(4)5/h4H,3H2,1-2H3,(H,5,6,7);1H2,2H3,(H,5,6);2H,1H2,(H2,4,5) |
| InChIKey | APBNNCSEZDWSHG-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 134.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropane-1-sulfonic acid;2-methylprop-2-enoic acid;prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropane-1-sulfonic acid;2-methylprop-2-enoic acid;prop-2-enamide?
The IUPAC name of 2-methylpropane-1-sulfonic acid;2-methylprop-2-enoic acid;prop-2-enamide (CID 157185498) is 2-methylpropane-1-sulfonic acid;2-methylprop-2-enoic acid;prop-2-enamide.
What is the SMILES notation for 2-methylpropane-1-sulfonic acid;2-methylprop-2-enoic acid;prop-2-enamide?
The canonical SMILES for 2-methylpropane-1-sulfonic acid;2-methylprop-2-enoic acid;prop-2-enamide is C=C(C)C(=O)O.C=CC(N)=O.CC(C)CS(=O)(=O)O.
What is the InChIKey of 2-methylpropane-1-sulfonic acid;2-methylprop-2-enoic acid;prop-2-enamide?
The InChIKey is APBNNCSEZDWSHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O3S.C4H6O2.C3H5NO/c1-4(2)3-8(5,6)7;1-3(2)4(5)6;1-2-3(4)5/h4H,3H2,1-2H3,(H,5,6,7);1H2,2H3,(H,5,6);2H,1H2,(H2,4,5).
What are the key properties of 2-methylpropane-1-sulfonic acid;2-methylprop-2-enoic acid;prop-2-enamide?
2-methylpropane-1-sulfonic acid;2-methylprop-2-enoic acid;prop-2-enamide has a molecular weight of 295.36 g/mol, XLogP of 0.83, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropane-1-sulfonic acid;2-methylprop-2-enoic acid;prop-2-enamide is sourced from PubChem (CID 157185498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).