About azane;2-methylpropyl N-prop-2-enoylsulfamate
azane;2-methylpropyl N-prop-2-enoylsulfamate (PubChem CID 174864475) has the molecular formula C7H16N2O4S
and a molecular weight of 224.28 g/mol. Its IUPAC name is azane;2-methylpropyl N-prop-2-enoylsulfamate.
Molecular Properties
| Compound Name | azane;2-methylpropyl N-prop-2-enoylsulfamate |
| PubChem CID | 174864475 |
| Molecular Formula | C7H16N2O4S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | azane;2-methylpropyl N-prop-2-enoylsulfamate |
| SMILES | C=CC(=O)NS(=O)(=O)OCC(C)C.N |
| InChI | InChI=1S/C7H13NO4S.H3N/c1-4-7(9)8-13(10,11)12-5-6(2)3;/h4,6H,1,5H2,2-3H3,(H,8,9);1H3 |
| InChIKey | NFEZOWPOAOWEEO-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 107.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze azane;2-methylpropyl N-prop-2-enoylsulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-methylpropyl N-prop-2-enoylsulfamate?
The IUPAC name of azane;2-methylpropyl N-prop-2-enoylsulfamate (CID 174864475) is azane;2-methylpropyl N-prop-2-enoylsulfamate.
What is the SMILES notation for azane;2-methylpropyl N-prop-2-enoylsulfamate?
The canonical SMILES for azane;2-methylpropyl N-prop-2-enoylsulfamate is C=CC(=O)NS(=O)(=O)OCC(C)C.N.
What is the InChIKey of azane;2-methylpropyl N-prop-2-enoylsulfamate?
The InChIKey is NFEZOWPOAOWEEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO4S.H3N/c1-4-7(9)8-13(10,11)12-5-6(2)3;/h4,6H,1,5H2,2-3H3,(H,8,9);1H3.
What are the key properties of azane;2-methylpropyl N-prop-2-enoylsulfamate?
azane;2-methylpropyl N-prop-2-enoylsulfamate has a molecular weight of 224.28 g/mol, XLogP of 0.37, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-methylpropyl N-prop-2-enoylsulfamate is sourced from PubChem (CID 174864475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).