About prop-2-enoylsulfamoyl propanoate
prop-2-enoylsulfamoyl propanoate (PubChem CID 174441844) has the molecular formula C6H9NO5S
and a molecular weight of 207.21 g/mol. Its IUPAC name is prop-2-enoylsulfamoyl propanoate.
Molecular Properties
| Compound Name | prop-2-enoylsulfamoyl propanoate |
| PubChem CID | 174441844 |
| Molecular Formula | C6H9NO5S |
| Molecular Weight | 207.21 g/mol |
| Exact Mass | 207.02 |
| IUPAC Name | prop-2-enoylsulfamoyl propanoate |
| SMILES | C=CC(=O)NS(=O)(=O)OC(=O)CC |
| InChI | InChI=1S/C6H9NO5S/c1-3-5(8)7-13(10,11)12-6(9)4-2/h3H,1,4H2,2H3,(H,7,8) |
| InChIKey | DCERNIQCWITLFC-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.21 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enoylsulfamoyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enoylsulfamoyl propanoate?
The IUPAC name of prop-2-enoylsulfamoyl propanoate (CID 174441844) is prop-2-enoylsulfamoyl propanoate.
What is the SMILES notation for prop-2-enoylsulfamoyl propanoate?
The canonical SMILES for prop-2-enoylsulfamoyl propanoate is C=CC(=O)NS(=O)(=O)OC(=O)CC.
What is the InChIKey of prop-2-enoylsulfamoyl propanoate?
The InChIKey is DCERNIQCWITLFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO5S/c1-3-5(8)7-13(10,11)12-6(9)4-2/h3H,1,4H2,2H3,(H,7,8).
What are the key properties of prop-2-enoylsulfamoyl propanoate?
prop-2-enoylsulfamoyl propanoate has a molecular weight of 207.21 g/mol, XLogP of -0.51, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enoylsulfamoyl propanoate is sourced from PubChem (CID 174441844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).