C8H15NO4S — CID 174766203
(prop-2-enoylamino) 3-methylbutane-1-sulfonate (PubChem CID 174766203) has the molecular formula C8H15NO4S and a molecular weight of 221.28 g/mol. Its IUPAC name is (prop-2-enoylamino) 3-methylbutane-1-sulfonate.
| Compound Name | (prop-2-enoylamino) 3-methylbutane-1-sulfonate |
|---|---|
| PubChem CID | 174766203 |
| Molecular Formula | C8H15NO4S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | (prop-2-enoylamino) 3-methylbutane-1-sulfonate |
| SMILES | C=CC(=O)NOS(=O)(=O)CCC(C)C |
| InChI | InChI=1S/C8H15NO4S/c1-4-8(10)9-13-14(11,12)6-5-7(2)3/h4,7H,1,5-6H2,2-3H3,(H,9,10) |
| InChIKey | GJSBPNFGYOWOKQ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|