About (2S)-3-[(2S)-1-aminopropan-2-yl]oxybutane-1,2,4-triol
(2S)-3-[(2S)-1-aminopropan-2-yl]oxybutane-1,2,4-triol (PubChem CID 89276164) has the molecular formula C7H17NO4
and a molecular weight of 179.22 g/mol. Its IUPAC name is (2S)-3-[(2S)-1-aminopropan-2-yl]oxybutane-1,2,4-triol.
Molecular Properties
| Compound Name | (2S)-3-[(2S)-1-aminopropan-2-yl]oxybutane-1,2,4-triol |
| PubChem CID | 89276164 |
| Molecular Formula | C7H17NO4 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.12 |
| IUPAC Name | (2S)-3-[(2S)-1-aminopropan-2-yl]oxybutane-1,2,4-triol |
| SMILES | C[C@@H](CN)OC(CO)[C@@H](O)CO |
| InChI | InChI=1S/C7H17NO4/c1-5(2-8)12-7(4-10)6(11)3-9/h5-7,9-11H,2-4,8H2,1H3/t5-,6-,7?/m0/s1 |
| InChIKey | JUULNWVUQUNPMQ-WABBHOIFSA-N |
| XLogP | -1.94 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-3-[(2S)-1-aminopropan-2-yl]oxybutane-1,2,4-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3-[(2S)-1-aminopropan-2-yl]oxybutane-1,2,4-triol?
The IUPAC name of (2S)-3-[(2S)-1-aminopropan-2-yl]oxybutane-1,2,4-triol (CID 89276164) is (2S)-3-[(2S)-1-aminopropan-2-yl]oxybutane-1,2,4-triol.
What is the SMILES notation for (2S)-3-[(2S)-1-aminopropan-2-yl]oxybutane-1,2,4-triol?
The canonical SMILES for (2S)-3-[(2S)-1-aminopropan-2-yl]oxybutane-1,2,4-triol is C[C@@H](CN)OC(CO)[C@@H](O)CO.
What is the InChIKey of (2S)-3-[(2S)-1-aminopropan-2-yl]oxybutane-1,2,4-triol?
The InChIKey is JUULNWVUQUNPMQ-WABBHOIFSA-N. The full InChI is InChI=1S/C7H17NO4/c1-5(2-8)12-7(4-10)6(11)3-9/h5-7,9-11H,2-4,8H2,1H3/t5-,6-,7?/m0/s1.
What are the key properties of (2S)-3-[(2S)-1-aminopropan-2-yl]oxybutane-1,2,4-triol?
(2S)-3-[(2S)-1-aminopropan-2-yl]oxybutane-1,2,4-triol has a molecular weight of 179.22 g/mol, XLogP of -1.94, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3-[(2S)-1-aminopropan-2-yl]oxybutane-1,2,4-triol is sourced from PubChem (CID 89276164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).