C8H14O4 — CID 88980070
(E,4R)-4-ethoxy-5,6-dihydroxyhex-2-enal (PubChem CID 88980070) has the molecular formula C8H14O4 and a molecular weight of 174.20 g/mol. Its IUPAC name is (E,4R)-4-ethoxy-5,6-dihydroxyhex-2-enal.
| Compound Name | (E,4R)-4-ethoxy-5,6-dihydroxyhex-2-enal |
|---|---|
| PubChem CID | 88980070 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | (E,4R)-4-ethoxy-5,6-dihydroxyhex-2-enal |
| SMILES | CCO[C@H](/C=C/C=O)C(O)CO |
| InChI | InChI=1S/C8H14O4/c1-2-12-8(4-3-5-9)7(11)6-10/h3-5,7-8,10-11H,2,6H2,1H3/b4-3+/t7?,8-/m1/s1 |
| InChIKey | PTUVGFPIZJVHBH-IXXAIKCISA-N |
| XLogP | -0.50 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|