C7H13BrO3 — CID 173475988
(3R)-5-bromo-3-ethoxypent-4-ene-1,2-diol (PubChem CID 173475988) has the molecular formula C7H13BrO3 and a molecular weight of 225.08 g/mol. Its IUPAC name is (3R)-5-bromo-3-ethoxypent-4-ene-1,2-diol.
| Compound Name | (3R)-5-bromo-3-ethoxypent-4-ene-1,2-diol |
|---|---|
| PubChem CID | 173475988 |
| Molecular Formula | C7H13BrO3 |
| Molecular Weight | 225.08 g/mol |
| Exact Mass | 224.00 |
| IUPAC Name | (3R)-5-bromo-3-ethoxypent-4-ene-1,2-diol |
| SMILES | CCO[C@H](C=CBr)C(O)CO |
| InChI | InChI=1S/C7H13BrO3/c1-2-11-7(3-4-8)6(10)5-9/h3-4,6-7,9-10H,2,5H2,1H3/t6?,7-/m1/s1 |
| InChIKey | OHERUHDNYXSZLY-COBSHVIPSA-N |
| XLogP | 0.65 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.08 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |