C8H13NO3 — CID 173475986
(4R)-4-ethoxy-5,6-dihydroxyhex-2-enenitrile (PubChem CID 173475986) has the molecular formula C8H13NO3 and a molecular weight of 171.20 g/mol. Its IUPAC name is (4R)-4-ethoxy-5,6-dihydroxyhex-2-enenitrile.
| Compound Name | (4R)-4-ethoxy-5,6-dihydroxyhex-2-enenitrile |
|---|---|
| PubChem CID | 173475986 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | (4R)-4-ethoxy-5,6-dihydroxyhex-2-enenitrile |
| SMILES | CCO[C@H](C=CC#N)C(O)CO |
| InChI | InChI=1S/C8H13NO3/c1-2-12-8(4-3-5-9)7(11)6-10/h3-4,7-8,10-11H,2,6H2,1H3/t7?,8-/m1/s1 |
| InChIKey | CZSUFTMOZWJVGD-BRFYHDHCSA-N |
| XLogP | -0.18 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|