C13H24O6 — CID 25260374
(2R,3S,4E,6R)-3,6-bis(methoxymethoxy)nona-4,8-diene-1,2-diol (PubChem CID 25260374) has the molecular formula C13H24O6 and a molecular weight of 276.33 g/mol. Its IUPAC name is (2R,3S,4E,6R)-3,6-bis(methoxymethoxy)nona-4,8-diene-1,2-diol.
| Compound Name | (2R,3S,4E,6R)-3,6-bis(methoxymethoxy)nona-4,8-diene-1,2-diol |
|---|---|
| PubChem CID | 25260374 |
| Molecular Formula | C13H24O6 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | (2R,3S,4E,6R)-3,6-bis(methoxymethoxy)nona-4,8-diene-1,2-diol |
| SMILES | C=CC[C@H](/C=C/[C@H](OCOC)[C@H](O)CO)OCOC |
| InChI | InChI=1S/C13H24O6/c1-4-5-11(18-9-16-2)6-7-13(12(15)8-14)19-10-17-3/h4,6-7,11-15H,1,5,8-10H2,2-3H3/b7-6+/t11-,12-,13+/m1/s1 |
| InChIKey | PNWGZGPKOZSLSR-SPAXLYFESA-N |
| XLogP | 0.45 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|