C22H38O5 — CID 88501623
3-(1,2-dihydroxyundeca-4,6-dien-3-yloxy)undeca-4,6-diene-1,2-diol (PubChem CID 88501623) has the molecular formula C22H38O5 and a molecular weight of 382.54 g/mol. Its IUPAC name is 3-(1,2-dihydroxyundeca-4,6-dien-3-yloxy)undeca-4,6-diene-1,2-diol.
| Compound Name | 3-(1,2-dihydroxyundeca-4,6-dien-3-yloxy)undeca-4,6-diene-1,2-diol |
|---|---|
| PubChem CID | 88501623 |
| Molecular Formula | C22H38O5 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | 3-(1,2-dihydroxyundeca-4,6-dien-3-yloxy)undeca-4,6-diene-1,2-diol |
| SMILES | CCCCC=CC=CC(OC(C=CC=CCCCC)C(O)CO)C(O)CO |
| InChI | InChI=1S/C22H38O5/c1-3-5-7-9-11-13-15-21(19(25)17-23)27-22(20(26)18-24)16-14-12-10-8-6-4-2/h9-16,19-26H,3-8,17-18H2,1-2H3 |
| InChIKey | BANMOZZOFIDIQI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|