C28H54O5 — CID 87991332
3-(1,2-dihydroxytetradec-4-en-3-yloxy)tetradec-4-ene-1,2-diol (PubChem CID 87991332) has the molecular formula C28H54O5 and a molecular weight of 470.74 g/mol. Its IUPAC name is 3-(1,2-dihydroxytetradec-4-en-3-yloxy)tetradec-4-ene-1,2-diol.
| Compound Name | 3-(1,2-dihydroxytetradec-4-en-3-yloxy)tetradec-4-ene-1,2-diol |
|---|---|
| PubChem CID | 87991332 |
| Molecular Formula | C28H54O5 |
| Molecular Weight | 470.74 g/mol |
| Exact Mass | 470.40 |
| IUPAC Name | 3-(1,2-dihydroxytetradec-4-en-3-yloxy)tetradec-4-ene-1,2-diol |
| SMILES | CCCCCCCCCC=CC(OC(C=CCCCCCCCCC)C(O)CO)C(O)CO |
| InChI | InChI=1S/C28H54O5/c1-3-5-7-9-11-13-15-17-19-21-27(25(31)23-29)33-28(26(32)24-30)22-20-18-16-14-12-10-8-6-4-2/h19-22,25-32H,3-18,23-24H2,1-2H3 |
| InChIKey | WPDQJMJDDPZDFS-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.74 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|