C21H43O3P — CID 173349308
3-octadec-9-enoxy-3-phosphanylpropane-1,2-diol (PubChem CID 173349308) has the molecular formula C21H43O3P and a molecular weight of 374.55 g/mol. Its IUPAC name is 3-octadec-9-enoxy-3-phosphanylpropane-1,2-diol.
| Compound Name | 3-octadec-9-enoxy-3-phosphanylpropane-1,2-diol |
|---|---|
| PubChem CID | 173349308 |
| Molecular Formula | C21H43O3P |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.29 |
| IUPAC Name | 3-octadec-9-enoxy-3-phosphanylpropane-1,2-diol |
| SMILES | CCCCCCCCC=CCCCCCCCCOC(P)C(O)CO |
| InChI | InChI=1S/C21H43O3P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-24-21(25)20(23)19-22/h9-10,20-23H,2-8,11-19,25H2,1H3 |
| InChIKey | HAIWPIRKWYYURY-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|