C24H48O4 — CID 173408731
2-(hydroxymethyl)-2-(1-octadec-9-enoxyethyl)propane-1,3-diol (PubChem CID 173408731) has the molecular formula C24H48O4 and a molecular weight of 400.64 g/mol. Its IUPAC name is 2-(hydroxymethyl)-2-(1-octadec-9-enoxyethyl)propane-1,3-diol.
| Compound Name | 2-(hydroxymethyl)-2-(1-octadec-9-enoxyethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 173408731 |
| Molecular Formula | C24H48O4 |
| Molecular Weight | 400.64 g/mol |
| Exact Mass | 400.36 |
| IUPAC Name | 2-(hydroxymethyl)-2-(1-octadec-9-enoxyethyl)propane-1,3-diol |
| SMILES | CCCCCCCCC=CCCCCCCCCOC(C)C(CO)(CO)CO |
| InChI | InChI=1S/C24H48O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-28-23(2)24(20-25,21-26)22-27/h10-11,23,25-27H,3-9,12-22H2,1-2H3 |
| InChIKey | WDAYQYRZHDKMAZ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.64 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|