C21H44O4 — CID 88725993
2-[(Z)-octadec-9-enoxy]propane-1,3-diol;hydrate (PubChem CID 88725993) has the molecular formula C21H44O4 and a molecular weight of 360.58 g/mol. Its IUPAC name is 2-[(Z)-octadec-9-enoxy]propane-1,3-diol;hydrate.
| Compound Name | 2-[(Z)-octadec-9-enoxy]propane-1,3-diol;hydrate |
|---|---|
| PubChem CID | 88725993 |
| Molecular Formula | C21H44O4 |
| Molecular Weight | 360.58 g/mol |
| Exact Mass | 360.32 |
| IUPAC Name | 2-[(Z)-octadec-9-enoxy]propane-1,3-diol;hydrate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOC(CO)CO.O |
| InChI | InChI=1S/C21H42O3.H2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-24-21(19-22)20-23;/h9-10,21-23H,2-8,11-20H2,1H3;1H2/b10-9-; |
| InChIKey | KIDQKQAXEYWGOF-KVVVOXFISA-N |
| XLogP | 4.57 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.58 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|