C18H36O4 — CID 102459917
(E,2R,3R,4R)-octadec-5-ene-1,2,3,4-tetrol (PubChem CID 102459917) has the molecular formula C18H36O4 and a molecular weight of 316.48 g/mol. Its IUPAC name is (E,2R,3R,4R)-octadec-5-ene-1,2,3,4-tetrol.
| Compound Name | (E,2R,3R,4R)-octadec-5-ene-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 102459917 |
| Molecular Formula | C18H36O4 |
| Molecular Weight | 316.48 g/mol |
| Exact Mass | 316.26 |
| IUPAC Name | (E,2R,3R,4R)-octadec-5-ene-1,2,3,4-tetrol |
| SMILES | CCCCCCCCCCCC/C=C/[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C18H36O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16(20)18(22)17(21)15-19/h13-14,16-22H,2-12,15H2,1H3/b14-13+/t16-,17-,18-/m1/s1 |
| InChIKey | SIGAUYUCDUPRSX-VOUPMTBQSA-N |
| XLogP | 2.93 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.48 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|