C12H26NO2+ — CID 126961029
[(E,2S,3R)-1,3-dihydroxydodec-4-en-2-yl]azanium (PubChem CID 126961029) has the molecular formula C12H26NO2+ and a molecular weight of 216.34 g/mol. Its IUPAC name is [(E,2S,3R)-1,3-dihydroxydodec-4-en-2-yl]azanium.
| Compound Name | [(E,2S,3R)-1,3-dihydroxydodec-4-en-2-yl]azanium |
|---|---|
| PubChem CID | 126961029 |
| Molecular Formula | C12H26NO2+ |
| Molecular Weight | 216.34 g/mol |
| Exact Mass | 216.20 |
| IUPAC Name | [(E,2S,3R)-1,3-dihydroxydodec-4-en-2-yl]azanium |
| SMILES | CCCCCCC/C=C/[C@@H](O)[C@@H]([NH3+])CO |
| InChI | InChI=1S/C12H25NO2/c1-2-3-4-5-6-7-8-9-12(15)11(13)10-14/h8-9,11-12,14-15H,2-7,10,13H2,1H3/p+1/b9-8+/t11-,12+/m0/s1 |
| InChIKey | NCNKWPUJUUMFNR-VDTGWRSZSA-O |
| XLogP | 0.87 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.34 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|