C18H38NO3+ — CID 91819912
[(Z,2S,3S,4R)-1,3,4-trihydroxyoctadec-8-en-2-yl]azanium (PubChem CID 91819912) has the molecular formula C18H38NO3+ and a molecular weight of 316.51 g/mol. Its IUPAC name is [(Z,2S,3S,4R)-1,3,4-trihydroxyoctadec-8-en-2-yl]azanium.
| Compound Name | [(Z,2S,3S,4R)-1,3,4-trihydroxyoctadec-8-en-2-yl]azanium |
|---|---|
| PubChem CID | 91819912 |
| Molecular Formula | C18H38NO3+ |
| Molecular Weight | 316.51 g/mol |
| Exact Mass | 316.28 |
| IUPAC Name | [(Z,2S,3S,4R)-1,3,4-trihydroxyoctadec-8-en-2-yl]azanium |
| SMILES | CCCCCCCCC/C=C\CCC[C@@H](O)[C@@H](O)[C@@H]([NH3+])CO |
| InChI | InChI=1S/C18H37NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17(21)18(22)16(19)15-20/h10-11,16-18,20-22H,2-9,12-15,19H2,1H3/p+1/b11-10-/t16-,17+,18-/m0/s1 |
| InChIKey | CQKNELOTFUSOTP-OGAXSGQXSA-O |
| XLogP | 2.18 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.51 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|