C12H20O — CID 86643741
(5E,7E)-dodeca-2,5,7-trien-4-ol (PubChem CID 86643741) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is (5E,7E)-dodeca-2,5,7-trien-4-ol.
| Compound Name | (5E,7E)-dodeca-2,5,7-trien-4-ol |
|---|---|
| PubChem CID | 86643741 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | (5E,7E)-dodeca-2,5,7-trien-4-ol |
| SMILES | CC=CC(O)/C=C/C=C/CCCC |
| InChI | InChI=1S/C12H20O/c1-3-5-6-7-8-9-11-12(13)10-4-2/h4,7-13H,3,5-6H2,1-2H3/b8-7+,10-4?,11-9+ |
| InChIKey | DTIZHBFYKPOYSW-JNYJAWLCSA-N |
| XLogP | 3.23 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|