C8H17NO6 — CID 174642001
acetamide;3,4,5,6-tetrahydroxyhexanal (PubChem CID 174642001) has the molecular formula C8H17NO6 and a molecular weight of 223.22 g/mol. Its IUPAC name is acetamide;3,4,5,6-tetrahydroxyhexanal.
| Compound Name | acetamide;3,4,5,6-tetrahydroxyhexanal |
|---|---|
| PubChem CID | 174642001 |
| Molecular Formula | C8H17NO6 |
| Molecular Weight | 223.22 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | acetamide;3,4,5,6-tetrahydroxyhexanal |
| SMILES | CC(N)=O.O=CCC(O)C(O)C(O)CO |
| InChI | InChI=1S/C6H12O5.C2H5NO/c7-2-1-4(9)6(11)5(10)3-8;1-2(3)4/h2,4-6,8-11H,1,3H2;1H3,(H2,3,4) |
| InChIKey | YKCYAZJPQCRKHF-UHFFFAOYSA-N |
| XLogP | -2.86 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.22 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|