C12H26N2O9S2 — CID 174424241
bis(2-amino-3-sulfanylpropanoic acid);3,4,5,6-tetrahydroxyhexanal (PubChem CID 174424241) has the molecular formula C12H26N2O9S2 and a molecular weight of 406.48 g/mol. Its IUPAC name is bis(2-amino-3-sulfanylpropanoic acid);3,4,5,6-tetrahydroxyhexanal.
| Compound Name | bis(2-amino-3-sulfanylpropanoic acid);3,4,5,6-tetrahydroxyhexanal |
|---|---|
| PubChem CID | 174424241 |
| Molecular Formula | C12H26N2O9S2 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | bis(2-amino-3-sulfanylpropanoic acid);3,4,5,6-tetrahydroxyhexanal |
| SMILES | NC(CS)C(=O)O.NC(CS)C(=O)O.O=CCC(O)C(O)C(O)CO |
| InChI | InChI=1S/C6H12O5.2C3H7NO2S/c7-2-1-4(9)6(11)5(10)3-8;2*4-2(1-7)3(5)6/h2,4-6,8-11H,1,3H2;2*2,7H,1,4H2,(H,5,6) |
| InChIKey | PGWUNWUYALVJMB-UHFFFAOYSA-N |
| XLogP | -3.69 |
| TPSA | 224.63 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | -3.69 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|