C10H19N3O2 — CID 11009289
(2S,3S)-3-azido-4-cyclohexylbutane-1,2-diol (PubChem CID 11009289) has the molecular formula C10H19N3O2 and a molecular weight of 213.28 g/mol. Its IUPAC name is (2S,3S)-3-azido-4-cyclohexylbutane-1,2-diol.
| Compound Name | (2S,3S)-3-azido-4-cyclohexylbutane-1,2-diol |
|---|---|
| PubChem CID | 11009289 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | (2S,3S)-3-azido-4-cyclohexylbutane-1,2-diol |
| SMILES | [N-]=[N+]=N[C@@H](CC1CCCCC1)[C@H](O)CO |
| InChI | InChI=1S/C10H19N3O2/c11-13-12-9(10(15)7-14)6-8-4-2-1-3-5-8/h8-10,14-15H,1-7H2/t9-,10+/m0/s1 |
| InChIKey | FWRIVNLGQNKSCG-VHSXEESVSA-N |
| XLogP | 1.99 |
| TPSA | 89.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|