C11H21ClN4O2 — CID 18631415
methyl (2S,3S)-3-amino-2-azido-4-cyclohexylbutanoate;hydrochloride (PubChem CID 18631415) has the molecular formula C11H21ClN4O2 and a molecular weight of 276.77 g/mol. Its IUPAC name is methyl (2S,3S)-3-amino-2-azido-4-cyclohexylbutanoate;hydrochloride.
| Compound Name | methyl (2S,3S)-3-amino-2-azido-4-cyclohexylbutanoate;hydrochloride |
|---|---|
| PubChem CID | 18631415 |
| Molecular Formula | C11H21ClN4O2 |
| Molecular Weight | 276.77 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | methyl (2S,3S)-3-amino-2-azido-4-cyclohexylbutanoate;hydrochloride |
| SMILES | COC(=O)[C@@H](N=[N+]=[N-])[C@@H](N)CC1CCCCC1.Cl |
| InChI | InChI=1S/C11H20N4O2.ClH/c1-17-11(16)10(14-15-13)9(12)7-8-5-3-2-4-6-8;/h8-10H,2-7,12H2,1H3;1H/t9-,10-;/m0./s1 |
| InChIKey | URPZWKZFYISSKN-IYPAPVHQSA-N |
| XLogP | 2.56 |
| TPSA | 101.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.77 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|