C15H26ClN5O3 — CID 175399297
methyl (2S,4R)-1-(2-amino-3-cyclohexylpropanoyl)-4-azidopyrrolidine-2-carboxylate;hydrochloride (PubChem CID 175399297) has the molecular formula C15H26ClN5O3 and a molecular weight of 359.86 g/mol. Its IUPAC name is methyl (2S,4R)-1-(2-amino-3-cyclohexylpropanoyl)-4-azidopyrrolidine-2-carboxylate;hydrochloride.
| Compound Name | methyl (2S,4R)-1-(2-amino-3-cyclohexylpropanoyl)-4-azidopyrrolidine-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 175399297 |
| Molecular Formula | C15H26ClN5O3 |
| Molecular Weight | 359.86 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | methyl (2S,4R)-1-(2-amino-3-cyclohexylpropanoyl)-4-azidopyrrolidine-2-carboxylate;hydrochloride |
| SMILES | COC(=O)[C@@H]1C[C@@H](N=[N+]=[N-])CN1C(=O)C(N)CC1CCCCC1.Cl |
| InChI | InChI=1S/C15H25N5O3.ClH/c1-23-15(22)13-8-11(18-19-17)9-20(13)14(21)12(16)7-10-5-3-2-4-6-10;/h10-13H,2-9,16H2,1H3;1H/t11-,12?,13+;/m1./s1 |
| InChIKey | VECCVOWOTZMSFQ-CSYBZOQDSA-N |
| XLogP | 2.16 |
| TPSA | 121.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.86 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|