C15H27ClN2O3 — CID 174947725
methyl (2S)-1-(2-amino-3-cyclohexylpropanoyl)pyrrolidine-2-carboxylate;hydrochloride (PubChem CID 174947725) has the molecular formula C15H27ClN2O3 and a molecular weight of 318.85 g/mol. Its IUPAC name is methyl (2S)-1-(2-amino-3-cyclohexylpropanoyl)pyrrolidine-2-carboxylate;hydrochloride.
| Compound Name | methyl (2S)-1-(2-amino-3-cyclohexylpropanoyl)pyrrolidine-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 174947725 |
| Molecular Formula | C15H27ClN2O3 |
| Molecular Weight | 318.85 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | methyl (2S)-1-(2-amino-3-cyclohexylpropanoyl)pyrrolidine-2-carboxylate;hydrochloride |
| SMILES | COC(=O)[C@@H]1CCCN1C(=O)C(N)CC1CCCCC1.Cl |
| InChI | InChI=1S/C15H26N2O3.ClH/c1-20-15(19)13-8-5-9-17(13)14(18)12(16)10-11-6-3-2-4-7-11;/h11-13H,2-10,16H2,1H3;1H/t12?,13-;/m0./s1 |
| InChIKey | QXEZJTIVXLZPLN-ZEDZUCNESA-N |
| XLogP | 1.87 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.85 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |