C16H26N2O4 — CID 173252396
ethyl 2-[(2S)-1-(2-amino-3-cyclopentylpropanoyl)pyrrolidin-2-yl]-2-oxoacetate (PubChem CID 173252396) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is ethyl 2-[(2S)-1-(2-amino-3-cyclopentylpropanoyl)pyrrolidin-2-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[(2S)-1-(2-amino-3-cyclopentylpropanoyl)pyrrolidin-2-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 173252396 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | ethyl 2-[(2S)-1-(2-amino-3-cyclopentylpropanoyl)pyrrolidin-2-yl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)[C@@H]1CCCN1C(=O)C(N)CC1CCCC1 |
| InChI | InChI=1S/C16H26N2O4/c1-2-22-16(21)14(19)13-8-5-9-18(13)15(20)12(17)10-11-6-3-4-7-11/h11-13H,2-10,17H2,1H3/t12?,13-/m0/s1 |
| InChIKey | FXXMCRAQLWNRGX-ABLWVSNPSA-N |
| XLogP | 1.02 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|