C13H24N2O3S — CID 104907897
ethyl 1-[(2R)-2-amino-4-methylsulfanylbutanoyl]piperidine-2-carboxylate (PubChem CID 104907897) has the molecular formula C13H24N2O3S and a molecular weight of 288.41 g/mol. Its IUPAC name is ethyl 1-[(2R)-2-amino-4-methylsulfanylbutanoyl]piperidine-2-carboxylate.
| Compound Name | ethyl 1-[(2R)-2-amino-4-methylsulfanylbutanoyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 104907897 |
| Molecular Formula | C13H24N2O3S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | ethyl 1-[(2R)-2-amino-4-methylsulfanylbutanoyl]piperidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCCN1C(=O)[C@H](N)CCSC |
| InChI | InChI=1S/C13H24N2O3S/c1-3-18-13(17)11-6-4-5-8-15(11)12(16)10(14)7-9-19-2/h10-11H,3-9,14H2,1-2H3/t10-,11?/m1/s1 |
| InChIKey | SGDHWEIIQBQBAV-NFJWQWPMSA-N |
| XLogP | 1.01 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |