C13H24N2OS — CID 104908618
(2R)-1-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-2-amino-4-methylsulfanylbutan-1-one (PubChem CID 104908618) has the molecular formula C13H24N2OS and a molecular weight of 256.41 g/mol. Its IUPAC name is (2R)-1-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-2-amino-4-methylsulfanylbutan-1-one.
| Compound Name | (2R)-1-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-2-amino-4-methylsulfanylbutan-1-one |
|---|---|
| PubChem CID | 104908618 |
| Molecular Formula | C13H24N2OS |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | (2R)-1-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-2-amino-4-methylsulfanylbutan-1-one |
| SMILES | CSCC[C@@H](N)C(=O)N1CCCC2CCCC21 |
| InChI | InChI=1S/C13H24N2OS/c1-17-9-7-11(14)13(16)15-8-3-5-10-4-2-6-12(10)15/h10-12H,2-9,14H2,1H3/t10?,11-,12?/m1/s1 |
| InChIKey | VIUVMTNTLJXTAL-MOENNCHZSA-N |
| XLogP | 1.86 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |