C6H11N3O6 — CID 152765716
(2R,3S,4S,5R)-3-azido-2,3,4,5,6-pentahydroxyhexanal (PubChem CID 152765716) has the molecular formula C6H11N3O6 and a molecular weight of 221.17 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-azido-2,3,4,5,6-pentahydroxyhexanal.
| Compound Name | (2R,3S,4S,5R)-3-azido-2,3,4,5,6-pentahydroxyhexanal |
|---|---|
| PubChem CID | 152765716 |
| Molecular Formula | C6H11N3O6 |
| Molecular Weight | 221.17 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | (2R,3S,4S,5R)-3-azido-2,3,4,5,6-pentahydroxyhexanal |
| SMILES | [N-]=[N+]=N[C@@](O)([C@@H](O)C=O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H11N3O6/c7-9-8-6(15,4(13)2-11)5(14)3(12)1-10/h2-5,10,12-15H,1H2/t3-,4+,5+,6-/m1/s1 |
| InChIKey | YSIURXAFBSFDDL-DPYQTVNSSA-N |
| XLogP | -2.74 |
| TPSA | 166.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.17 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|