C6H13O9P — CID 174492611
[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxy-1-oxohexan-3-yl]phosphonic acid (PubChem CID 174492611) has the molecular formula C6H13O9P and a molecular weight of 260.13 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxy-1-oxohexan-3-yl]phosphonic acid.
| Compound Name | [(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxy-1-oxohexan-3-yl]phosphonic acid |
|---|---|
| PubChem CID | 174492611 |
| Molecular Formula | C6H13O9P |
| Molecular Weight | 260.13 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | [(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxy-1-oxohexan-3-yl]phosphonic acid |
| SMILES | O=C[C@H](O)[C@@](O)([C@H](O)[C@H](O)CO)P(=O)(O)O |
| InChI | InChI=1S/C6H13O9P/c7-1-3(9)5(11)6(12,4(10)2-8)16(13,14)15/h2-5,7,9-12H,1H2,(H2,13,14,15)/t3-,4+,5-,6+/m1/s1 |
| InChIKey | PJKJQHWURSCYJV-MOJAZDJTSA-N |
| XLogP | -3.87 |
| TPSA | 175.75 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.13 |
| LogP ≤ 5 | -3.87 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|