C7H14O7 — CID 18957545
2,3,4,5,6-pentahydroxy-3-methylhexanoic acid (PubChem CID 18957545) has the molecular formula C7H14O7 and a molecular weight of 210.18 g/mol. Its IUPAC name is 2,3,4,5,6-pentahydroxy-3-methylhexanoic acid.
| Compound Name | 2,3,4,5,6-pentahydroxy-3-methylhexanoic acid |
|---|---|
| PubChem CID | 18957545 |
| Molecular Formula | C7H14O7 |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 2,3,4,5,6-pentahydroxy-3-methylhexanoic acid |
| SMILES | CC(O)(C(O)C(=O)O)C(O)C(O)CO |
| InChI | InChI=1S/C7H14O7/c1-7(14,5(11)6(12)13)4(10)3(9)2-8/h3-5,8-11,14H,2H2,1H3,(H,12,13) |
| InChIKey | WDZOYYHKDNDXKO-UHFFFAOYSA-N |
| XLogP | -3.10 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.18 |
| LogP ≤ 5 | -3.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |