3-formyl-3,4-dihydroxy-2-oxobutanoic acid

C5H6O6 — CID 87300881

IUPAC3-formyl-3,4-dihydroxy-2-oxobutanoic acid
SMILESO=CC(O)(CO)C(=O)C(=O)O
InChIInChI=1S/C5H6O6/c6-1-5(11,2-7)3(8)4(9)10/h1,7,11H,2H2,(H,9,10)
InChIKeyYGBUPOFFXJRHDE-UHFFFAOYSA-N
MW162.10 g/mol
LogP-2.44
Rot. Bonds4

About 3-formyl-3,4-dihydroxy-2-oxobutanoic acid

3-formyl-3,4-dihydroxy-2-oxobutanoic acid (PubChem CID 87300881) has the molecular formula C5H6O6 and a molecular weight of 162.10 g/mol. Its IUPAC name is 3-formyl-3,4-dihydroxy-2-oxobutanoic acid.

Molecular Properties

Compound Name3-formyl-3,4-dihydroxy-2-oxobutanoic acid
PubChem CID87300881
Molecular FormulaC5H6O6
Molecular Weight162.10 g/mol
Exact Mass162.02
IUPAC Name3-formyl-3,4-dihydroxy-2-oxobutanoic acid
SMILESO=CC(O)(CO)C(=O)C(=O)O
InChIInChI=1S/C5H6O6/c6-1-5(11,2-7)3(8)4(9)10/h1,7,11H,2H2,(H,9,10)
InChIKeyYGBUPOFFXJRHDE-UHFFFAOYSA-N
XLogP-2.44
TPSA111.90 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500162.10
LogP ≤ 5-2.44
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 3-formyl-3,4-dihydroxy-2-oxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-formyl-3,4-dihydroxy-2-oxobutanoic acid?
The IUPAC name of 3-formyl-3,4-dihydroxy-2-oxobutanoic acid (CID 87300881) is 3-formyl-3,4-dihydroxy-2-oxobutanoic acid.
What is the SMILES notation for 3-formyl-3,4-dihydroxy-2-oxobutanoic acid?
The canonical SMILES for 3-formyl-3,4-dihydroxy-2-oxobutanoic acid is O=CC(O)(CO)C(=O)C(=O)O.
What is the InChIKey of 3-formyl-3,4-dihydroxy-2-oxobutanoic acid?
The InChIKey is YGBUPOFFXJRHDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O6/c6-1-5(11,2-7)3(8)4(9)10/h1,7,11H,2H2,(H,9,10).
What are the key properties of 3-formyl-3,4-dihydroxy-2-oxobutanoic acid?
3-formyl-3,4-dihydroxy-2-oxobutanoic acid has a molecular weight of 162.10 g/mol, XLogP of -2.44, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-formyl-3,4-dihydroxy-2-oxobutanoic acid is sourced from PubChem (CID 87300881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).