About acetic acid;3-(hydroxymethyl)-2,3-dimethylpentane-2,4-diol
acetic acid;3-(hydroxymethyl)-2,3-dimethylpentane-2,4-diol (PubChem CID 162322991) has the molecular formula C10H22O5
and a molecular weight of 222.28 g/mol. Its IUPAC name is acetic acid;3-(hydroxymethyl)-2,3-dimethylpentane-2,4-diol.
Analyze acetic acid;3-(hydroxymethyl)-2,3-dimethylpentane-2,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;3-(hydroxymethyl)-2,3-dimethylpentane-2,4-diol?
The IUPAC name of acetic acid;3-(hydroxymethyl)-2,3-dimethylpentane-2,4-diol (CID 162322991) is acetic acid;3-(hydroxymethyl)-2,3-dimethylpentane-2,4-diol.
What is the SMILES notation for acetic acid;3-(hydroxymethyl)-2,3-dimethylpentane-2,4-diol?
The canonical SMILES for acetic acid;3-(hydroxymethyl)-2,3-dimethylpentane-2,4-diol is CC(=O)O.CC(O)C(C)(CO)C(C)(C)O.
What is the InChIKey of acetic acid;3-(hydroxymethyl)-2,3-dimethylpentane-2,4-diol?
The InChIKey is FUTBFBCIJTVYAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O3.C2H4O2/c1-6(10)8(4,5-9)7(2,3)11;1-2(3)4/h6,9-11H,5H2,1-4H3;1H3,(H,3,4).
What are the key properties of acetic acid;3-(hydroxymethyl)-2,3-dimethylpentane-2,4-diol?
acetic acid;3-(hydroxymethyl)-2,3-dimethylpentane-2,4-diol has a molecular weight of 222.28 g/mol, XLogP of 0.23, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;3-(hydroxymethyl)-2,3-dimethylpentane-2,4-diol is sourced from PubChem (CID 162322991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).