C6H12Br2NO5P — CID 143939571
2-(dibromoamino)-4-methyl-2-phosphonopentanoic acid (PubChem CID 143939571) has the molecular formula C6H12Br2NO5P and a molecular weight of 368.95 g/mol. Its IUPAC name is 2-(dibromoamino)-4-methyl-2-phosphonopentanoic acid.
| Compound Name | 2-(dibromoamino)-4-methyl-2-phosphonopentanoic acid |
|---|---|
| PubChem CID | 143939571 |
| Molecular Formula | C6H12Br2NO5P |
| Molecular Weight | 368.95 g/mol |
| Exact Mass | 366.88 |
| IUPAC Name | 2-(dibromoamino)-4-methyl-2-phosphonopentanoic acid |
| SMILES | CC(C)CC(C(=O)O)(N(Br)Br)P(=O)(O)O |
| InChI | InChI=1S/C6H12Br2NO5P/c1-4(2)3-6(5(10)11,9(7)8)15(12,13)14/h4H,3H2,1-2H3,(H,10,11)(H2,12,13,14) |
| InChIKey | OWTLFZBCAGPWHY-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.95 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|