C10H14O10P2S — CID 21465007
2,4-diphosphono-2-(thiophen-3-ylmethyl)pentanedioic acid (PubChem CID 21465007) has the molecular formula C10H14O10P2S and a molecular weight of 388.23 g/mol. Its IUPAC name is 2,4-diphosphono-2-(thiophen-3-ylmethyl)pentanedioic acid.
| Compound Name | 2,4-diphosphono-2-(thiophen-3-ylmethyl)pentanedioic acid |
|---|---|
| PubChem CID | 21465007 |
| Molecular Formula | C10H14O10P2S |
| Molecular Weight | 388.23 g/mol |
| Exact Mass | 387.98 |
| IUPAC Name | 2,4-diphosphono-2-(thiophen-3-ylmethyl)pentanedioic acid |
| SMILES | O=C(O)C(CC(Cc1ccsc1)(C(=O)O)P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C10H14O10P2S/c11-8(12)7(21(15,16)17)4-10(9(13)14,22(18,19)20)3-6-1-2-23-5-6/h1-2,5,7H,3-4H2,(H,11,12)(H,13,14)(H2,15,16,17)(H2,18,19,20) |
| InChIKey | ZNNQSCZGORSCHZ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 189.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.23 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|