About 2-bromo-N-(4,4-difluorobutan-2-yl)acetamide
2-bromo-N-(4,4-difluorobutan-2-yl)acetamide (PubChem CID 131206669) has the molecular formula C6H10BrF2NO
and a molecular weight of 230.05 g/mol. Its IUPAC name is 2-bromo-N-(4,4-difluorobutan-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-bromo-N-(4,4-difluorobutan-2-yl)acetamide |
| PubChem CID | 131206669 |
| Molecular Formula | C6H10BrF2NO |
| Molecular Weight | 230.05 g/mol |
| Exact Mass | 228.99 |
| IUPAC Name | 2-bromo-N-(4,4-difluorobutan-2-yl)acetamide |
| SMILES | CC(CC(F)F)NC(=O)CBr |
| InChI | InChI=1S/C6H10BrF2NO/c1-4(2-5(8)9)10-6(11)3-7/h4-5H,2-3H2,1H3,(H,10,11) |
| InChIKey | QGKMHCYFGACUMF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.05 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-N-(4,4-difluorobutan-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N-(4,4-difluorobutan-2-yl)acetamide?
The IUPAC name of 2-bromo-N-(4,4-difluorobutan-2-yl)acetamide (CID 131206669) is 2-bromo-N-(4,4-difluorobutan-2-yl)acetamide.
What is the SMILES notation for 2-bromo-N-(4,4-difluorobutan-2-yl)acetamide?
The canonical SMILES for 2-bromo-N-(4,4-difluorobutan-2-yl)acetamide is CC(CC(F)F)NC(=O)CBr.
What is the InChIKey of 2-bromo-N-(4,4-difluorobutan-2-yl)acetamide?
The InChIKey is QGKMHCYFGACUMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10BrF2NO/c1-4(2-5(8)9)10-6(11)3-7/h4-5H,2-3H2,1H3,(H,10,11).
What are the key properties of 2-bromo-N-(4,4-difluorobutan-2-yl)acetamide?
2-bromo-N-(4,4-difluorobutan-2-yl)acetamide has a molecular weight of 230.05 g/mol, XLogP of 1.54, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N-(4,4-difluorobutan-2-yl)acetamide is sourced from PubChem (CID 131206669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).