C6H10BrF2NO — CID 131206669
2-bromo-N-(4,4-difluorobutan-2-yl)acetamide (PubChem CID 131206669) has the molecular formula C6H10BrF2NO and a molecular weight of 230.05 g/mol. Its IUPAC name is 2-bromo-N-(4,4-difluorobutan-2-yl)acetamide.
| Compound Name | 2-bromo-N-(4,4-difluorobutan-2-yl)acetamide |
|---|---|
| PubChem CID | 131206669 |
| Molecular Formula | C6H10BrF2NO |
| Molecular Weight | 230.05 g/mol |
| Exact Mass | 228.99 |
| IUPAC Name | 2-bromo-N-(4,4-difluorobutan-2-yl)acetamide |
| SMILES | CC(CC(F)F)NC(=O)CBr |
| InChI | InChI=1S/C6H10BrF2NO/c1-4(2-5(8)9)10-6(11)3-7/h4-5H,2-3H2,1H3,(H,10,11) |
| InChIKey | QGKMHCYFGACUMF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.05 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|