C10H25N3O3 — CID 85452180
N'-(1-amino-6,7-dihydroxyoctyl)ethanimidamide;hydrate (PubChem CID 85452180) has the molecular formula C10H25N3O3 and a molecular weight of 235.33 g/mol. Its IUPAC name is N'-(1-amino-6,7-dihydroxyoctyl)ethanimidamide;hydrate.
| Compound Name | N'-(1-amino-6,7-dihydroxyoctyl)ethanimidamide;hydrate |
|---|---|
| PubChem CID | 85452180 |
| Molecular Formula | C10H25N3O3 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | N'-(1-amino-6,7-dihydroxyoctyl)ethanimidamide;hydrate |
| SMILES | CC(N)=NC(N)CCCCC(O)C(C)O.O |
| InChI | InChI=1S/C10H23N3O2.H2O/c1-7(14)9(15)5-3-4-6-10(12)13-8(2)11;/h7,9-10,14-15H,3-6,12H2,1-2H3,(H2,11,13);1H2 |
| InChIKey | JZJAZCYPIZVXCF-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 136.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|