C12H25N3O2 — CID 70269935
N'-[1-amino-5-(2,2-dimethyl-1,3-dioxolan-4-yl)pentyl]ethanimidamide (PubChem CID 70269935) has the molecular formula C12H25N3O2 and a molecular weight of 243.35 g/mol. Its IUPAC name is N'-[1-amino-5-(2,2-dimethyl-1,3-dioxolan-4-yl)pentyl]ethanimidamide.
| Compound Name | N'-[1-amino-5-(2,2-dimethyl-1,3-dioxolan-4-yl)pentyl]ethanimidamide |
|---|---|
| PubChem CID | 70269935 |
| Molecular Formula | C12H25N3O2 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.19 |
| IUPAC Name | N'-[1-amino-5-(2,2-dimethyl-1,3-dioxolan-4-yl)pentyl]ethanimidamide |
| SMILES | CC(N)=NC(N)CCCCC1COC(C)(C)O1 |
| InChI | InChI=1S/C12H25N3O2/c1-9(13)15-11(14)7-5-4-6-10-8-16-12(2,3)17-10/h10-11H,4-8,14H2,1-3H3,(H2,13,15) |
| InChIKey | QPWPYVGDSKXDQB-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|