C11H22O4 — CID 13319189
4-(4,4-dimethoxybutyl)-2,2-dimethyl-1,3-dioxolane (PubChem CID 13319189) has the molecular formula C11H22O4 and a molecular weight of 218.29 g/mol. Its IUPAC name is 4-(4,4-dimethoxybutyl)-2,2-dimethyl-1,3-dioxolane.
| Compound Name | 4-(4,4-dimethoxybutyl)-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 13319189 |
| Molecular Formula | C11H22O4 |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 4-(4,4-dimethoxybutyl)-2,2-dimethyl-1,3-dioxolane |
| SMILES | COC(CCCC1COC(C)(C)O1)OC |
| InChI | InChI=1S/C11H22O4/c1-11(2)14-8-9(15-11)6-5-7-10(12-3)13-4/h9-10H,5-8H2,1-4H3 |
| InChIKey | UMNSFEOBTCOYRK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|